![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
_009.png){kind=link}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Apple2: from the XScreenSaver 5.20-3.fc17 distribution (30-Oct-2012.)_009.png | 2013-02-07 17:18 | 189K | |
| yr-2012-07-07.png | 2012-07-07 23:19 | 16K | |
| openfire.png | 2012-03-02 16:36 | 26K | |
| xen-deepthought.png | 2012-03-01 22:02 | 30K | |
| jonlol.png | 2012-02-29 09:21 | 16K | |
| rt.png | 2012-02-24 13:59 | 24K | |
| sherlock001.png | 2012-02-08 13:34 | 48K | |
| Selection_001.bmp | 2012-02-08 13:34 | 1.1M | |
| award.png | 2011-10-21 10:36 | 5.2K | |
| bovanstyle.png | 2011-09-29 16:35 | 294K | |
| bacon.png | 2011-09-26 23:50 | 226K | |
| New Virtual Machine Wizard_002.png | 2011-09-16 12:50 | 74K | |
| Connect to Server_001.png | 2011-09-16 12:49 | 21K | |
| Selection_001.png | 2011-09-10 22:13 | 43K | |
| Capture Agents | Opencast Matterhorn - Mozilla Firefox_005.png | 2011-08-23 11:31 | 55K | |
| x-nautilus-desktop_004.png | 2011-08-17 12:25 | 2.3M | |
| lyn.png | 2011-07-22 16:41 | 22K | |
| screenshot-petunia-2011-07-22.png | 2011-07-22 01:06 | 749K | |
| einars-iphone.local - Remote Desktop Viewer_006.png | 2011-07-19 11:46 | 70K | |
| einars-iphone.local - Remote Desktop Viewer_005.png | 2011-07-19 11:43 | 109K | |
| iphone-vnc.png | 2011-07-19 10:46 | 366K | |
| ringen2-transformers.png | 2011-07-14 18:04 | 49K | |
| Nettbillett - Oslokino.no - Google Chrome_004.png | 2011-07-14 17:42 | 43K | |
| Matterhorn server_003.png | 2011-07-06 12:42 | 71K | |
| latitude1.png | 2011-06-23 14:20 | 203K | |
| matpakke.png | 2011-05-24 15:22 | 47K | |
| irssi.png | 2011-05-18 10:43 | 652K | |
| seenkirneh.png | 2011-05-11 09:20 | 44K | |
| no_love.png | 2011-04-29 11:09 | 38K | |
| design_vs_utvikling.png | 2011-04-07 09:34 | 328K | |
| jesus_kommer.png | 2011-04-05 09:38 | 46K | |
| Selection_009.png | 2011-04-05 09:38 | 46K | |
| HiG - Høgskolen i Gjøvik - Google Chrome_002.png | 2011-04-01 07:30 | 540K | |
| roser-eddie.png | 2011-03-24 18:07 | 99K | |
| ffffffuuuuuuu.png | 2011-03-23 19:11 | 33K | |
| rundinger.png | 2011-03-18 19:12 | 1.6K | |
| adobe_connect_sucks.png | 2011-03-10 10:17 | 411K | |
| einar@petunia: ~_002.png | 2011-03-09 23:48 | 216K | |
| wide2.png | 2010-05-30 21:24 | 4.9M | |
| vmware/ | 2010-05-30 21:24 | - | |
| xchat.png | 2010-05-30 21:23 | 101K | |
| teitehest.jpg | 2010-05-30 21:23 | 181K | |
| Screenshot-irssi - .png | 2010-05-30 21:23 | 260K | |
| Epiphany.png | 2010-05-30 21:23 | 249K | |
| timenor.png | 2010-05-30 21:23 | 43K | |
| dual.jpg | 2010-05-30 21:23 | 163K | |
| Screenshot-Edith.png | 2010-05-30 21:23 | 84K | |
| Screenshot-22.png | 2010-05-30 21:23 | 1.0M | |
| Screenshot-epiphany.png | 2010-05-30 21:23 | 234K | |
| Screenshot-efnet.png | 2010-05-30 21:23 | 135K | |
| NeroLINUX.png | 2010-05-30 21:23 | 83K | |
| 1234567890.png | 2010-05-30 21:23 | 1.6M | |
| Screenshot-azureus.png | 2010-05-30 21:23 | 31K | |
| Screenshot-060503.png | 2010-05-30 21:23 | 397K | |
| DSC00016.JPG | 2010-05-30 21:23 | 356K | |
| Screenshot-agrajag_tn.png | 2010-05-30 21:23 | 28K | |
| Screenshot-agrajag.png | 2010-05-30 21:23 | 214K | |
| Screenshot-Spillegal-Firefox.png | 2010-05-30 21:23 | 214K | |
| Screenshot-SWT.png | 2010-05-30 21:23 | 44K | |
| Screenshot-EFnet: #kopweb.png | 2010-05-30 21:23 | 196K | |
| Epiphany2.png | 2010-05-30 21:23 | 267K | |
| work.png | 2010-05-30 21:23 | 6.0M | |
| linuxdcpp.png | 2010-05-30 21:23 | 98K | |
| Screenshot-Evolution.png | 2010-05-30 21:23 | 175K | |
| netshop.png | 2010-05-30 21:23 | 103K | |
| Screenshot-PayPal-EasyISP-1337.png | 2010-05-30 21:23 | 61K | |
| Screenshot-Miracle Drug - Muine Music Player.png | 2010-05-30 21:23 | 51K | |
| Screenshot-1.png | 2010-05-30 21:23 | 1.0M | |
| Gaim_2.0.0.png | 2010-05-30 21:23 | 110K | |
| ScreenshotJuli2007.png | 2010-05-30 21:23 | 1.3M | |
| Screenshot-IRC.png | 2010-05-30 21:23 | 349K | |
| wide.png | 2010-05-30 21:23 | 1.4M | |
